C16H13BrFNO3S — CID 68942058
3-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide (PubChem CID 68942058) has the molecular formula C16H13BrFNO3S and a molecular weight of 398.25 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide.
| Compound Name | 3-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 68942058 |
| Molecular Formula | C16H13BrFNO3S |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 3-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide |
| SMILES | NC(=O)C(=Cc1ccc(Br)cc1)S(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13BrFNO3S/c17-13-5-1-11(2-6-13)9-15(16(19)20)23(21,22)10-12-3-7-14(18)8-4-12/h1-9H,10H2,(H2,19,20) |
| InChIKey | GSYGPJNTZAMMFY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|