C16H12Cl3NO3S — CID 68949500
3-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enamide (PubChem CID 68949500) has the molecular formula C16H12Cl3NO3S and a molecular weight of 404.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 68949500 |
| Molecular Formula | C16H12Cl3NO3S |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enamide |
| SMILES | NC(=O)C(=Cc1ccc(Cl)cc1)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO3S/c17-12-4-1-10(2-5-12)7-15(16(20)21)24(22,23)9-11-3-6-13(18)8-14(11)19/h1-8H,9H2,(H2,20,21) |
| InChIKey | YHSNCLVHVHXIPL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|