C9H10Cl2O3S — CID 82181727
2-[(2,4-dichlorophenyl)methylsulfonyl]ethanol (PubChem CID 82181727) has the molecular formula C9H10Cl2O3S and a molecular weight of 269.15 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfonyl]ethanol.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]ethanol |
|---|---|
| PubChem CID | 82181727 |
| Molecular Formula | C9H10Cl2O3S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]ethanol |
| SMILES | O=S(=O)(CCO)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2O3S/c10-8-2-1-7(9(11)5-8)6-15(13,14)4-3-12/h1-2,5,12H,3-4,6H2 |
| InChIKey | XZRVOYBIHYTGNQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |