C12H17ClO5S — CID 60563014
2-[2-[(5-chloro-2-methoxyphenyl)methylsulfonyl]ethoxy]ethanol (PubChem CID 60563014) has the molecular formula C12H17ClO5S and a molecular weight of 308.78 g/mol. Its IUPAC name is 2-[2-[(5-chloro-2-methoxyphenyl)methylsulfonyl]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-chloro-2-methoxyphenyl)methylsulfonyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 60563014 |
| Molecular Formula | C12H17ClO5S |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[2-[(5-chloro-2-methoxyphenyl)methylsulfonyl]ethoxy]ethanol |
| SMILES | COc1ccc(Cl)cc1CS(=O)(=O)CCOCCO |
| InChI | InChI=1S/C12H17ClO5S/c1-17-12-3-2-11(13)8-10(12)9-19(15,16)7-6-18-5-4-14/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | SGUFIIDGSJLXNV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|