C12H17ClO5S — CID 104666078
[5-chloro-2-(2-ethylsulfonylethoxy)-3-methoxyphenyl]methanol (PubChem CID 104666078) has the molecular formula C12H17ClO5S and a molecular weight of 308.78 g/mol. Its IUPAC name is [5-chloro-2-(2-ethylsulfonylethoxy)-3-methoxyphenyl]methanol.
| Compound Name | [5-chloro-2-(2-ethylsulfonylethoxy)-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 104666078 |
| Molecular Formula | C12H17ClO5S |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [5-chloro-2-(2-ethylsulfonylethoxy)-3-methoxyphenyl]methanol |
| SMILES | CCS(=O)(=O)CCOc1c(CO)cc(Cl)cc1OC |
| InChI | InChI=1S/C12H17ClO5S/c1-3-19(15,16)5-4-18-12-9(8-14)6-10(13)7-11(12)17-2/h6-7,14H,3-5,8H2,1-2H3 |
| InChIKey | DEBMOEZGLNJDPC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |