C12H16Cl2O4S — CID 104666222
5-chloro-1-(chloromethyl)-2-(2-ethylsulfonylethoxy)-3-methoxybenzene (PubChem CID 104666222) has the molecular formula C12H16Cl2O4S and a molecular weight of 327.23 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-2-(2-ethylsulfonylethoxy)-3-methoxybenzene.
| Compound Name | 5-chloro-1-(chloromethyl)-2-(2-ethylsulfonylethoxy)-3-methoxybenzene |
|---|---|
| PubChem CID | 104666222 |
| Molecular Formula | C12H16Cl2O4S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-2-(2-ethylsulfonylethoxy)-3-methoxybenzene |
| SMILES | CCS(=O)(=O)CCOc1c(CCl)cc(Cl)cc1OC |
| InChI | InChI=1S/C12H16Cl2O4S/c1-3-19(15,16)5-4-18-12-9(8-13)6-10(14)7-11(12)17-2/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | ORINQFQHSPZADY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|