C17H18Cl2O2 — CID 104666195
5-chloro-1-(chloromethyl)-2-[(3,4-dimethylphenyl)methoxy]-3-methoxybenzene (PubChem CID 104666195) has the molecular formula C17H18Cl2O2 and a molecular weight of 325.24 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-2-[(3,4-dimethylphenyl)methoxy]-3-methoxybenzene.
| Compound Name | 5-chloro-1-(chloromethyl)-2-[(3,4-dimethylphenyl)methoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 104666195 |
| Molecular Formula | C17H18Cl2O2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-2-[(3,4-dimethylphenyl)methoxy]-3-methoxybenzene |
| SMILES | COc1cc(Cl)cc(CCl)c1OCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H18Cl2O2/c1-11-4-5-13(6-12(11)2)10-21-17-14(9-18)7-15(19)8-16(17)20-3/h4-8H,9-10H2,1-3H3 |
| InChIKey | BQROGBVXCJGTPH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|