C14H12BrCl2NO2 — CID 104799223
5-bromo-2-[[4-chloro-2-(chloromethyl)-6-methoxyphenoxy]methyl]pyridine (PubChem CID 104799223) has the molecular formula C14H12BrCl2NO2 and a molecular weight of 377.07 g/mol. Its IUPAC name is 5-bromo-2-[[4-chloro-2-(chloromethyl)-6-methoxyphenoxy]methyl]pyridine.
| Compound Name | 5-bromo-2-[[4-chloro-2-(chloromethyl)-6-methoxyphenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 104799223 |
| Molecular Formula | C14H12BrCl2NO2 |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 5-bromo-2-[[4-chloro-2-(chloromethyl)-6-methoxyphenoxy]methyl]pyridine |
| SMILES | COc1cc(Cl)cc(CCl)c1OCc1ccc(Br)cn1 |
| InChI | InChI=1S/C14H12BrCl2NO2/c1-19-13-5-11(17)4-9(6-16)14(13)20-8-12-3-2-10(15)7-18-12/h2-5,7H,6,8H2,1H3 |
| InChIKey | DZIUFFNWYGOXGR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|