C15H12Cl4O2 — CID 107306943
5-chloro-1-(chloromethyl)-2-[(2,3-dichlorophenyl)methoxy]-3-methoxybenzene (PubChem CID 107306943) has the molecular formula C15H12Cl4O2 and a molecular weight of 366.07 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-2-[(2,3-dichlorophenyl)methoxy]-3-methoxybenzene.
| Compound Name | 5-chloro-1-(chloromethyl)-2-[(2,3-dichlorophenyl)methoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 107306943 |
| Molecular Formula | C15H12Cl4O2 |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-2-[(2,3-dichlorophenyl)methoxy]-3-methoxybenzene |
| SMILES | COc1cc(Cl)cc(CCl)c1OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl4O2/c1-20-13-6-11(17)5-10(7-16)15(13)21-8-9-3-2-4-12(18)14(9)19/h2-6H,7-8H2,1H3 |
| InChIKey | UGUGPTIBSJMKLY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|