C13H9BrCl3NO — CID 104799100
5-bromo-2-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]pyridine (PubChem CID 104799100) has the molecular formula C13H9BrCl3NO and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-bromo-2-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]pyridine.
| Compound Name | 5-bromo-2-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 104799100 |
| Molecular Formula | C13H9BrCl3NO |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 378.89 |
| IUPAC Name | 5-bromo-2-[[2,4-dichloro-6-(chloromethyl)phenoxy]methyl]pyridine |
| SMILES | ClCc1cc(Cl)cc(Cl)c1OCc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H9BrCl3NO/c14-9-1-2-11(18-6-9)7-19-13-8(5-15)3-10(16)4-12(13)17/h1-4,6H,5,7H2 |
| InChIKey | NOTSYVLZKBUBCX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|