C11H6Cl4N2O — CID 104514161
3-chloro-6-[(2,4,6-trichlorophenoxy)methyl]pyridazine (PubChem CID 104514161) has the molecular formula C11H6Cl4N2O and a molecular weight of 323.99 g/mol. Its IUPAC name is 3-chloro-6-[(2,4,6-trichlorophenoxy)methyl]pyridazine.
| Compound Name | 3-chloro-6-[(2,4,6-trichlorophenoxy)methyl]pyridazine |
|---|---|
| PubChem CID | 104514161 |
| Molecular Formula | C11H6Cl4N2O |
| Molecular Weight | 323.99 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 3-chloro-6-[(2,4,6-trichlorophenoxy)methyl]pyridazine |
| SMILES | Clc1cc(Cl)c(OCc2ccc(Cl)nn2)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl4N2O/c12-6-3-8(13)11(9(14)4-6)18-5-7-1-2-10(15)17-16-7/h1-4H,5H2 |
| InChIKey | WJUKHPNTGHSLQC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.99 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |