C12H10Cl3N3O — CID 103058486
N-methyl-5-[(2,4,6-trichlorophenoxy)methyl]pyrazin-2-amine (PubChem CID 103058486) has the molecular formula C12H10Cl3N3O and a molecular weight of 318.59 g/mol. Its IUPAC name is N-methyl-5-[(2,4,6-trichlorophenoxy)methyl]pyrazin-2-amine.
| Compound Name | N-methyl-5-[(2,4,6-trichlorophenoxy)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 103058486 |
| Molecular Formula | C12H10Cl3N3O |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | N-methyl-5-[(2,4,6-trichlorophenoxy)methyl]pyrazin-2-amine |
| SMILES | CNc1cnc(COc2c(Cl)cc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C12H10Cl3N3O/c1-16-11-5-17-8(4-18-11)6-19-12-9(14)2-7(13)3-10(12)15/h2-5H,6H2,1H3,(H,16,18) |
| InChIKey | VDZKBZJFSQKPIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |