C12H14Cl4O — CID 63500210
1,3,5-trichloro-2-(6-chlorohexoxy)benzene (PubChem CID 63500210) has the molecular formula C12H14Cl4O and a molecular weight of 316.06 g/mol. Its IUPAC name is 1,3,5-trichloro-2-(6-chlorohexoxy)benzene.
| Compound Name | 1,3,5-trichloro-2-(6-chlorohexoxy)benzene |
|---|---|
| PubChem CID | 63500210 |
| Molecular Formula | C12H14Cl4O |
| Molecular Weight | 316.06 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1,3,5-trichloro-2-(6-chlorohexoxy)benzene |
| SMILES | ClCCCCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl4O/c13-5-3-1-2-4-6-17-12-10(15)7-9(14)8-11(12)16/h7-8H,1-6H2 |
| InChIKey | GPLHGVUEMNAYHN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.06 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|