C11H12Cl3NOS — CID 54966446
5-(2,4,6-trichlorophenoxy)pentanethioamide (PubChem CID 54966446) has the molecular formula C11H12Cl3NOS and a molecular weight of 312.65 g/mol. Its IUPAC name is 5-(2,4,6-trichlorophenoxy)pentanethioamide.
| Compound Name | 5-(2,4,6-trichlorophenoxy)pentanethioamide |
|---|---|
| PubChem CID | 54966446 |
| Molecular Formula | C11H12Cl3NOS |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 5-(2,4,6-trichlorophenoxy)pentanethioamide |
| SMILES | NC(=S)CCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NOS/c12-7-5-8(13)11(9(14)6-7)16-4-2-1-3-10(15)17/h5-6H,1-4H2,(H2,15,17) |
| InChIKey | BAFJALJICBRATD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|