C10H10Cl3NOS — CID 43175363
2-methyl-3-(2,4,6-trichlorophenoxy)propanethioamide (PubChem CID 43175363) has the molecular formula C10H10Cl3NOS and a molecular weight of 298.62 g/mol. Its IUPAC name is 2-methyl-3-(2,4,6-trichlorophenoxy)propanethioamide.
| Compound Name | 2-methyl-3-(2,4,6-trichlorophenoxy)propanethioamide |
|---|---|
| PubChem CID | 43175363 |
| Molecular Formula | C10H10Cl3NOS |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 2-methyl-3-(2,4,6-trichlorophenoxy)propanethioamide |
| SMILES | CC(COc1c(Cl)cc(Cl)cc1Cl)C(N)=S |
| InChI | InChI=1S/C10H10Cl3NOS/c1-5(10(14)16)4-15-9-7(12)2-6(11)3-8(9)13/h2-3,5H,4H2,1H3,(H2,14,16) |
| InChIKey | ILGVEIIBDMVRIY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|