C11H15Cl3NO2+ — CID 1409843
[(2R)-2-hydroxy-3-(2,4,6-trichlorophenoxy)propyl]-dimethylazanium (PubChem CID 1409843) has the molecular formula C11H15Cl3NO2+ and a molecular weight of 299.61 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(2,4,6-trichlorophenoxy)propyl]-dimethylazanium.
| Compound Name | [(2R)-2-hydroxy-3-(2,4,6-trichlorophenoxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 1409843 |
| Molecular Formula | C11H15Cl3NO2+ |
| Molecular Weight | 299.61 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | [(2R)-2-hydroxy-3-(2,4,6-trichlorophenoxy)propyl]-dimethylazanium |
| SMILES | C[NH+](C)C[C@@H](O)COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO2/c1-15(2)5-8(16)6-17-11-9(13)3-7(12)4-10(11)14/h3-4,8,16H,5-6H2,1-2H3/p+1/t8-/m1/s1 |
| InChIKey | IELWSMOKSKLORL-MRVPVSSYSA-O |
| XLogP | 1.53 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.61 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |