C11H11Cl3O2 — CID 63907675
1-cyclopropyl-2-(2,4,6-trichlorophenoxy)ethanol (PubChem CID 63907675) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,4,6-trichlorophenoxy)ethanol.
| Compound Name | 1-cyclopropyl-2-(2,4,6-trichlorophenoxy)ethanol |
|---|---|
| PubChem CID | 63907675 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 1-cyclopropyl-2-(2,4,6-trichlorophenoxy)ethanol |
| SMILES | OC(COc1c(Cl)cc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C11H11Cl3O2/c12-7-3-8(13)11(9(14)4-7)16-5-10(15)6-1-2-6/h3-4,6,10,15H,1-2,5H2 |
| InChIKey | BSSSKTRPUPTDRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |