C14H20Cl2O2 — CID 113438867
5-chloro-1-(chloromethyl)-2-(2-ethylbutoxy)-3-methoxybenzene (PubChem CID 113438867) has the molecular formula C14H20Cl2O2 and a molecular weight of 291.22 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-2-(2-ethylbutoxy)-3-methoxybenzene.
| Compound Name | 5-chloro-1-(chloromethyl)-2-(2-ethylbutoxy)-3-methoxybenzene |
|---|---|
| PubChem CID | 113438867 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-2-(2-ethylbutoxy)-3-methoxybenzene |
| SMILES | CCC(CC)COc1c(CCl)cc(Cl)cc1OC |
| InChI | InChI=1S/C14H20Cl2O2/c1-4-10(5-2)9-18-14-11(8-15)6-12(16)7-13(14)17-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | GSWSKNFLKRNGRI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|