C13H18ClF2NO2 — CID 104667098
1-[5-chloro-2-(2,2-difluoroethoxy)-3-methoxyphenyl]butan-2-amine (PubChem CID 104667098) has the molecular formula C13H18ClF2NO2 and a molecular weight of 293.74 g/mol. Its IUPAC name is 1-[5-chloro-2-(2,2-difluoroethoxy)-3-methoxyphenyl]butan-2-amine.
| Compound Name | 1-[5-chloro-2-(2,2-difluoroethoxy)-3-methoxyphenyl]butan-2-amine |
|---|---|
| PubChem CID | 104667098 |
| Molecular Formula | C13H18ClF2NO2 |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-[5-chloro-2-(2,2-difluoroethoxy)-3-methoxyphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Cl)cc(OC)c1OCC(F)F |
| InChI | InChI=1S/C13H18ClF2NO2/c1-3-10(17)5-8-4-9(14)6-11(18-2)13(8)19-7-12(15)16/h4,6,10,12H,3,5,7,17H2,1-2H3 |
| InChIKey | WVMZLRIEUNEFPJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |