C12H16ClF2NO — CID 112615794
1-[3-chloro-2-(2,2-difluoroethoxy)phenyl]butan-2-amine (PubChem CID 112615794) has the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. Its IUPAC name is 1-[3-chloro-2-(2,2-difluoroethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3-chloro-2-(2,2-difluoroethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 112615794 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-[3-chloro-2-(2,2-difluoroethoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cccc(Cl)c1OCC(F)F |
| InChI | InChI=1S/C12H16ClF2NO/c1-2-9(16)6-8-4-3-5-10(13)12(8)17-7-11(14)15/h3-5,9,11H,2,6-7,16H2,1H3 |
| InChIKey | PWXPEOFXSGAIFW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |