C15H21Cl2NO2 — CID 106439695
1-[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]butan-2-amine (PubChem CID 106439695) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 1-[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]butan-2-amine.
| Compound Name | 1-[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]butan-2-amine |
|---|---|
| PubChem CID | 106439695 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Cl)cc(OC)c1OC/C(C)=C/Cl |
| InChI | InChI=1S/C15H21Cl2NO2/c1-4-13(18)6-11-5-12(17)7-14(19-3)15(11)20-9-10(2)8-16/h5,7-8,13H,4,6,9,18H2,1-3H3/b10-8+ |
| InChIKey | OSHNHEFETUBMNJ-CSKARUKUSA-N |
| XLogP | 4.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |