C14H20Cl2O3 — CID 106454056
5-chloro-1-(chloromethyl)-3-methoxy-2-[2-(2-methylpropoxy)ethoxy]benzene (PubChem CID 106454056) has the molecular formula C14H20Cl2O3 and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-3-methoxy-2-[2-(2-methylpropoxy)ethoxy]benzene.
| Compound Name | 5-chloro-1-(chloromethyl)-3-methoxy-2-[2-(2-methylpropoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 106454056 |
| Molecular Formula | C14H20Cl2O3 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-3-methoxy-2-[2-(2-methylpropoxy)ethoxy]benzene |
| SMILES | COc1cc(Cl)cc(CCl)c1OCCOCC(C)C |
| InChI | InChI=1S/C14H20Cl2O3/c1-10(2)9-18-4-5-19-14-11(8-15)6-12(16)7-13(14)17-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | BSMZEIABDJHWPC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|