C13H15Cl2F3O3 — CID 104666332
5-chloro-1-(chloromethyl)-3-methoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene (PubChem CID 104666332) has the molecular formula C13H15Cl2F3O3 and a molecular weight of 347.16 g/mol. Its IUPAC name is 5-chloro-1-(chloromethyl)-3-methoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene.
| Compound Name | 5-chloro-1-(chloromethyl)-3-methoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
|---|---|
| PubChem CID | 104666332 |
| Molecular Formula | C13H15Cl2F3O3 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 5-chloro-1-(chloromethyl)-3-methoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
| SMILES | COc1cc(Cl)cc(CCl)c1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H15Cl2F3O3/c1-19-11-6-10(15)5-9(7-14)12(11)21-4-2-3-20-8-13(16,17)18/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | NNDRMDFLIOVXGY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|