C14H20ClNO4S — CID 104664947
N-[[5-chloro-3-methoxy-2-(2-methylsulfonylethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 104664947) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is N-[[5-chloro-3-methoxy-2-(2-methylsulfonylethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-chloro-3-methoxy-2-(2-methylsulfonylethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 104664947 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[[5-chloro-3-methoxy-2-(2-methylsulfonylethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(Cl)cc(CNC2CC2)c1OCCS(C)(=O)=O |
| InChI | InChI=1S/C14H20ClNO4S/c1-19-13-8-11(15)7-10(9-16-12-3-4-12)14(13)20-5-6-21(2,17)18/h7-8,12,16H,3-6,9H2,1-2H3 |
| InChIKey | WUNHESDHPYRYIT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |