C13H16Cl2O2S — CID 123509149
2,4-dichloro-1-(3-methylpent-2-en-2-ylsulfonylmethyl)benzene (PubChem CID 123509149) has the molecular formula C13H16Cl2O2S and a molecular weight of 307.24 g/mol. Its IUPAC name is 2,4-dichloro-1-(3-methylpent-2-en-2-ylsulfonylmethyl)benzene.
| Compound Name | 2,4-dichloro-1-(3-methylpent-2-en-2-ylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 123509149 |
| Molecular Formula | C13H16Cl2O2S |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2,4-dichloro-1-(3-methylpent-2-en-2-ylsulfonylmethyl)benzene |
| SMILES | CCC(C)=C(C)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2O2S/c1-4-9(2)10(3)18(16,17)8-11-5-6-12(14)7-13(11)15/h5-7H,4,8H2,1-3H3 |
| InChIKey | BSRFJBKVMYRBFK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |