C12H14Cl2O5S — CID 22592997
methyl 2-[(2,4-dichlorophenyl)methylsulfonyloxy]-2-methylpropanoate (PubChem CID 22592997) has the molecular formula C12H14Cl2O5S and a molecular weight of 341.21 g/mol. Its IUPAC name is methyl 2-[(2,4-dichlorophenyl)methylsulfonyloxy]-2-methylpropanoate.
| Compound Name | methyl 2-[(2,4-dichlorophenyl)methylsulfonyloxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 22592997 |
| Molecular Formula | C12H14Cl2O5S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | methyl 2-[(2,4-dichlorophenyl)methylsulfonyloxy]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)OS(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O5S/c1-12(2,11(15)18-3)19-20(16,17)7-8-4-5-9(13)6-10(8)14/h4-6H,7H2,1-3H3 |
| InChIKey | UHGHPXBZYKBDPF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|