C16H16Cl2O3S — CID 4616103
1-[(2,4-dichlorophenyl)methylsulfonyl]-2-phenylpropan-2-ol (PubChem CID 4616103) has the molecular formula C16H16Cl2O3S and a molecular weight of 359.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylsulfonyl]-2-phenylpropan-2-ol.
| Compound Name | 1-[(2,4-dichlorophenyl)methylsulfonyl]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 4616103 |
| Molecular Formula | C16H16Cl2O3S |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylsulfonyl]-2-phenylpropan-2-ol |
| SMILES | CC(O)(CS(=O)(=O)Cc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16Cl2O3S/c1-16(19,13-5-3-2-4-6-13)11-22(20,21)10-12-7-8-14(17)9-15(12)18/h2-9,19H,10-11H2,1H3 |
| InChIKey | KNXRWLAXFFIMEJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |