C21H25Cl2NO — CID 133225084
3-(2,4-dichlorophenyl)-N-(4-methyl-4-phenylpentan-2-yl)propanamide (PubChem CID 133225084) has the molecular formula C21H25Cl2NO and a molecular weight of 378.34 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(4-methyl-4-phenylpentan-2-yl)propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(4-methyl-4-phenylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 133225084 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(4-methyl-4-phenylpentan-2-yl)propanamide |
| SMILES | CC(CC(C)(C)c1ccccc1)NC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2NO/c1-15(14-21(2,3)17-7-5-4-6-8-17)24-20(25)12-10-16-9-11-18(22)13-19(16)23/h4-9,11,13,15H,10,12,14H2,1-3H3,(H,24,25) |
| InChIKey | SZWRIYUFUIESQY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |