C13H13Cl2F2NO3 — CID 129465879
(2R)-2-[3-(2,4-dichlorophenyl)propanoylamino]-4,4-difluorobutanoic acid (PubChem CID 129465879) has the molecular formula C13H13Cl2F2NO3 and a molecular weight of 340.15 g/mol. Its IUPAC name is (2R)-2-[3-(2,4-dichlorophenyl)propanoylamino]-4,4-difluorobutanoic acid.
| Compound Name | (2R)-2-[3-(2,4-dichlorophenyl)propanoylamino]-4,4-difluorobutanoic acid |
|---|---|
| PubChem CID | 129465879 |
| Molecular Formula | C13H13Cl2F2NO3 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (2R)-2-[3-(2,4-dichlorophenyl)propanoylamino]-4,4-difluorobutanoic acid |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)N[C@H](CC(F)F)C(=O)O |
| InChI | InChI=1S/C13H13Cl2F2NO3/c14-8-3-1-7(9(15)5-8)2-4-12(19)18-10(13(20)21)6-11(16)17/h1,3,5,10-11H,2,4,6H2,(H,18,19)(H,20,21)/t10-/m1/s1 |
| InChIKey | QWACDEMVMZWAIR-SNVBAGLBSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |