C12H12Cl2N2O4 — CID 61142148
(2S)-4-amino-2-[[2-(2,4-dichlorophenyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 61142148) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-(2,4-dichlorophenyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-(2,4-dichlorophenyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61142148 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (2S)-4-amino-2-[[2-(2,4-dichlorophenyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)Cc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H12Cl2N2O4/c13-7-2-1-6(8(14)4-7)3-11(18)16-9(12(19)20)5-10(15)17/h1-2,4,9H,3,5H2,(H2,15,17)(H,16,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | XCJRKRNTNBYHOO-VIFPVBQESA-N |
| XLogP | 0.98 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |