C13H15BrClNO3 — CID 120687050
2-[3-(2-bromo-5-chlorophenyl)propanoylamino]butanoic acid (PubChem CID 120687050) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-[3-(2-bromo-5-chlorophenyl)propanoylamino]butanoic acid.
| Compound Name | 2-[3-(2-bromo-5-chlorophenyl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 120687050 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-[3-(2-bromo-5-chlorophenyl)propanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)CCc1cc(Cl)ccc1Br)C(=O)O |
| InChI | InChI=1S/C13H15BrClNO3/c1-2-11(13(18)19)16-12(17)6-3-8-7-9(15)4-5-10(8)14/h4-5,7,11H,2-3,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | RHJNTHYUPLWRAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |