C10H12Cl2O4S — CID 95973022
(2S)-3-[(2,4-dichlorophenyl)methylsulfonyl]propane-1,2-diol (PubChem CID 95973022) has the molecular formula C10H12Cl2O4S and a molecular weight of 299.18 g/mol. Its IUPAC name is (2S)-3-[(2,4-dichlorophenyl)methylsulfonyl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2,4-dichlorophenyl)methylsulfonyl]propane-1,2-diol |
|---|---|
| PubChem CID | 95973022 |
| Molecular Formula | C10H12Cl2O4S |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | (2S)-3-[(2,4-dichlorophenyl)methylsulfonyl]propane-1,2-diol |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1Cl)C[C@@H](O)CO |
| InChI | InChI=1S/C10H12Cl2O4S/c11-8-2-1-7(10(12)3-8)5-17(15,16)6-9(14)4-13/h1-3,9,13-14H,4-6H2/t9-/m0/s1 |
| InChIKey | NOXWYLPVAOBMGW-VIFPVBQESA-N |
| XLogP | 1.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |