C16H11Cl2NO4S — CID 68943109
(E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,4-dihydroxyphenyl)prop-2-enenitrile (PubChem CID 68943109) has the molecular formula C16H11Cl2NO4S and a molecular weight of 384.24 g/mol. Its IUPAC name is (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,4-dihydroxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,4-dihydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68943109 |
| Molecular Formula | C16H11Cl2NO4S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,4-dihydroxyphenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)cc1O)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO4S/c17-12-3-1-11(15(18)6-12)9-24(22,23)14(8-19)5-10-2-4-13(20)7-16(10)21/h1-7,20-21H,9H2/b14-5+ |
| InChIKey | NJBHEOJJDFGAAG-LHHJGKSTSA-N |
| XLogP | 3.88 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|