C19H17Cl2NO5S — CID 68940910
2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 68940910) has the molecular formula C19H17Cl2NO5S and a molecular weight of 442.32 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68940910 |
| Molecular Formula | C19H17Cl2NO5S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)S(=O)(=O)Cc2ccc(Cl)cc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C19H17Cl2NO5S/c1-25-17-7-5-12(18(26-2)19(17)27-3)8-15(10-22)28(23,24)11-13-4-6-14(20)9-16(13)21/h4-9H,11H2,1-3H3 |
| InChIKey | IMIILTIKFJZCHR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|