C16H10Cl2FNO2S — CID 68946912
(E)-3-(2,4-dichlorophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 68946912) has the molecular formula C16H10Cl2FNO2S and a molecular weight of 370.23 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68946912 |
| Molecular Formula | C16H10Cl2FNO2S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1Cl)S(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H10Cl2FNO2S/c17-13-4-3-12(16(18)8-13)7-15(9-20)23(21,22)10-11-1-5-14(19)6-2-11/h1-8H,10H2/b15-7+ |
| InChIKey | XPFDHHYNZBPULB-VIZOYTHASA-N |
| XLogP | 4.61 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|