C18H12BrClN2O2S — CID 68945682
(Z)-3-(5-bromo-1H-indol-3-yl)-2-[(4-chlorophenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 68945682) has the molecular formula C18H12BrClN2O2S and a molecular weight of 435.73 g/mol. Its IUPAC name is (Z)-3-(5-bromo-1H-indol-3-yl)-2-[(4-chlorophenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(5-bromo-1H-indol-3-yl)-2-[(4-chlorophenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68945682 |
| Molecular Formula | C18H12BrClN2O2S |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | (Z)-3-(5-bromo-1H-indol-3-yl)-2-[(4-chlorophenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1c[nH]c2ccc(Br)cc12)S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12BrClN2O2S/c19-14-3-6-18-17(8-14)13(10-22-18)7-16(9-21)25(23,24)11-12-1-4-15(20)5-2-12/h1-8,10,22H,11H2/b16-7- |
| InChIKey | WMRFJNYABMJOKO-APSNUPSMSA-N |
| XLogP | 5.06 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|