C12H8BrN3O — CID 3150781
3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enamide (PubChem CID 3150781) has the molecular formula C12H8BrN3O and a molecular weight of 290.12 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enamide.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 3150781 |
| Molecular Formula | C12H8BrN3O |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1c[nH]c2ccc(Br)cc12)C(N)=O |
| InChI | InChI=1S/C12H8BrN3O/c13-9-1-2-11-10(4-9)8(6-16-11)3-7(5-14)12(15)17/h1-4,6,16H,(H2,15,17) |
| InChIKey | BPSQFGPZMCCZID-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|