C10H10BrN5 — CID 135460270
2-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]guanidine (PubChem CID 135460270) has the molecular formula C10H10BrN5 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]guanidine.
| Compound Name | 2-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 135460270 |
| Molecular Formula | C10H10BrN5 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C\c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C10H10BrN5/c11-7-1-2-9-8(3-7)6(4-14-9)5-15-16-10(12)13/h1-5,14H,(H4,12,13,16)/b15-5- |
| InChIKey | FENBNNFSZUQLQX-WCSRMQSCSA-N |
| XLogP | 1.54 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|