C22H16BrN3 — CID 135676058
(E)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-diphenylmethanimine (PubChem CID 135676058) has the molecular formula C22H16BrN3 and a molecular weight of 402.30 g/mol. Its IUPAC name is (E)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-diphenylmethanimine.
| Compound Name | (E)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 135676058 |
| Molecular Formula | C22H16BrN3 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (E)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-diphenylmethanimine |
| SMILES | Brc1ccc2[nH]cc(/C=N/N=C(c3ccccc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C22H16BrN3/c23-19-11-12-21-20(13-19)18(14-24-21)15-25-26-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,24H/b25-15+ |
| InChIKey | WDRFNCZOHNOADU-MFKUBSTISA-N |
| XLogP | 5.80 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|