C20H14Br2N2O — CID 135675783
2-[(E)-(benzhydrylidenehydrazinylidene)methyl]-4,6-dibromophenol (PubChem CID 135675783) has the molecular formula C20H14Br2N2O and a molecular weight of 458.15 g/mol. Its IUPAC name is 2-[(E)-(benzhydrylidenehydrazinylidene)methyl]-4,6-dibromophenol.
| Compound Name | 2-[(E)-(benzhydrylidenehydrazinylidene)methyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 135675783 |
| Molecular Formula | C20H14Br2N2O |
| Molecular Weight | 458.15 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 2-[(E)-(benzhydrylidenehydrazinylidene)methyl]-4,6-dibromophenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H14Br2N2O/c21-17-11-16(20(25)18(22)12-17)13-23-24-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,25H/b23-13+ |
| InChIKey | LBUOYJCXTZXTHF-YDZHTSKRSA-N |
| XLogP | 5.79 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.15 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|