C16H16BrN5 — CID 168592786
2-[(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)methylideneamino]guanidine (PubChem CID 168592786) has the molecular formula C16H16BrN5 and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-[(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)methylideneamino]guanidine.
| Compound Name | 2-[(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592786 |
| Molecular Formula | C16H16BrN5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-[(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)methylideneamino]guanidine |
| SMILES | Cc1cc(C=NN=C(N)N)c(C)c2c1[nH]c1ccc(Br)cc12 |
| InChI | InChI=1S/C16H16BrN5/c1-8-5-10(7-20-22-16(18)19)9(2)14-12-6-11(17)3-4-13(12)21-15(8)14/h3-7,21H,1-2H3,(H4,18,19,22) |
| InChIKey | QAOLWCWMWHSZEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|