C18H18BrN5 — CID 24885019
2-[(E)-2-[5-bromo-2-(4-methylphenyl)-1H-indol-3-yl]ethylideneamino]guanidine (PubChem CID 24885019) has the molecular formula C18H18BrN5 and a molecular weight of 384.28 g/mol. Its IUPAC name is 2-[(E)-2-[5-bromo-2-(4-methylphenyl)-1H-indol-3-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-2-[5-bromo-2-(4-methylphenyl)-1H-indol-3-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 24885019 |
| Molecular Formula | C18H18BrN5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[(E)-2-[5-bromo-2-(4-methylphenyl)-1H-indol-3-yl]ethylideneamino]guanidine |
| SMILES | Cc1ccc(-c2[nH]c3ccc(Br)cc3c2C/C=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C18H18BrN5/c1-11-2-4-12(5-3-11)17-14(8-9-22-24-18(20)21)15-10-13(19)6-7-16(15)23-17/h2-7,9-10,23H,8H2,1H3,(H4,20,21,24)/b22-9+ |
| InChIKey | XONZSMURFXYZQB-LSFURLLWSA-N |
| XLogP | 3.71 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|