C19H11BrF3N3O — CID 5237781
3-(5-bromo-1H-indol-3-yl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 5237781) has the molecular formula C19H11BrF3N3O and a molecular weight of 434.22 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5237781 |
| Molecular Formula | C19H11BrF3N3O |
| Molecular Weight | 434.22 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1c[nH]c2ccc(Br)cc12)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11BrF3N3O/c20-14-4-5-17-16(8-14)12(10-25-17)6-11(9-24)18(27)26-15-3-1-2-13(7-15)19(21,22)23/h1-8,10,25H,(H,26,27) |
| InChIKey | MOTVNHBWZCODRK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.22 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|