C20H13F3N4O — CID 17368984
(Z)-2-cyano-3-(5-phenyl-1H-pyrazol-4-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 17368984) has the molecular formula C20H13F3N4O and a molecular weight of 382.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-phenyl-1H-pyrazol-4-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-phenyl-1H-pyrazol-4-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17368984 |
| Molecular Formula | C20H13F3N4O |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (Z)-2-cyano-3-(5-phenyl-1H-pyrazol-4-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cn[nH]c1-c1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F3N4O/c21-20(22,23)16-7-4-8-17(10-16)26-19(28)14(11-24)9-15-12-25-27-18(15)13-5-2-1-3-6-13/h1-10,12H,(H,25,27)(H,26,28)/b14-9- |
| InChIKey | XWRSIBWGJQRMOR-ZROIWOOFSA-N |
| XLogP | 4.64 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|