C20H15FN4O — CID 6132282
(E)-2-cyano-N-(2-fluorophenyl)-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide (PubChem CID 6132282) has the molecular formula C20H15FN4O and a molecular weight of 346.37 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-fluorophenyl)-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-fluorophenyl)-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6132282 |
| Molecular Formula | C20H15FN4O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (E)-2-cyano-N-(2-fluorophenyl)-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2[nH]ncc2/C=C(\C#N)C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H15FN4O/c1-13-6-8-14(9-7-13)19-16(12-23-25-19)10-15(11-22)20(26)24-18-5-3-2-4-17(18)21/h2-10,12H,1H3,(H,23,25)(H,24,26)/b15-10+ |
| InChIKey | QQHVISLAFNNIPT-XNTDXEJSSA-N |
| XLogP | 4.07 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|