C20H16N4O — CID 18806970
(Z)-2-cyano-N-(3-methylphenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide (PubChem CID 18806970) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-methylphenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-methylphenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18806970 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-2-cyano-N-(3-methylphenyl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\c2cn[nH]c2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H16N4O/c1-14-6-5-9-18(10-14)23-20(25)16(12-21)11-17-13-22-24-19(17)15-7-3-2-4-8-15/h2-11,13H,1H3,(H,22,24)(H,23,25)/b16-11- |
| InChIKey | LHLXLPMHJBWBQD-WJDWOHSUSA-N |
| XLogP | 3.93 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|