C23H22N4O — CID 40559365
(E)-2-cyano-N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide (PubChem CID 40559365) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 40559365 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (E)-2-cyano-N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)/C(C#N)=C/c2cn[nH]c2-c2ccccc2)cc1C |
| InChI | InChI=1S/C23H22N4O/c1-15-9-10-19(11-16(15)2)17(3)26-23(28)20(13-24)12-21-14-25-27-22(21)18-7-5-4-6-8-18/h4-12,14,17H,1-3H3,(H,25,27)(H,26,28)/b20-12+/t17-/m0/s1 |
| InChIKey | CQGUVMLYNIOGAS-RONKMWSCSA-N |
| XLogP | 4.48 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|