C23H22N4O3 — CID 47495325
2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide (PubChem CID 47495325) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47495325 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)C(C#N)=Cc2cn[nH]c2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H22N4O3/c1-29-20-9-8-16(12-21(20)30-2)10-11-25-23(28)18(14-24)13-19-15-26-27-22(19)17-6-4-3-5-7-17/h3-9,12-13,15H,10-11H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | KMTAJEUWWIVCKK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|