C23H21FN4O3 — CID 5051715
2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]prop-2-enamide (PubChem CID 5051715) has the molecular formula C23H21FN4O3 and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5051715 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)C(C#N)=Cc2cn[nH]c2-c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C23H21FN4O3/c1-30-20-8-3-15(11-21(20)31-2)9-10-26-23(29)17(13-25)12-18-14-27-28-22(18)16-4-6-19(24)7-5-16/h3-8,11-12,14H,9-10H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | BSZRTNHSXVOBFH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|