C20H22N4O3 — CID 108836492
(Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide (PubChem CID 108836492) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108836492 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-3-pyridinyl)amino]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2ccc(C)nc2)cc1OC |
| InChI | InChI=1S/C20H22N4O3/c1-14-4-6-17(13-23-14)24-12-16(11-21)20(25)22-9-8-15-5-7-18(26-2)19(10-15)27-3/h4-7,10,12-13,24H,8-9H2,1-3H3,(H,22,25)/b16-12- |
| InChIKey | NVRBYHBHAJUBGP-VBKFSLOCSA-N |
| XLogP | 2.59 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|